C8H12N4O2 — CID 103248691
(E)-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoic acid (PubChem CID 103248691) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is (E)-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103248691 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (E)-3-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoic acid |
| SMILES | CC(N/C=C/C(=O)O)c1nncn1C |
| InChI | InChI=1S/C8H12N4O2/c1-6(9-4-3-7(13)14)8-11-10-5-12(8)2/h3-6,9H,1-2H3,(H,13,14)/b4-3+ |
| InChIKey | LWMUCCHBQKSMCR-ONEGZZNKSA-N |
| XLogP | 0.06 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|