C10H15NO5 — CID 103248940
3-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-2-carboxylic acid (PubChem CID 103248940) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 3-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103248940 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-[[2-(2-hydroxyethoxy)ethylamino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1CNCCOCCO |
| InChI | InChI=1S/C10H15NO5/c12-3-6-15-5-2-11-7-8-1-4-16-9(8)10(13)14/h1,4,11-12H,2-3,5-7H2,(H,13,14) |
| InChIKey | PRYOQPNAHKZGTN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|