C13H20N2O4 — CID 103263112
3-[[[3-(tert-butylamino)-3-oxopropyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 103263112) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[[[3-(tert-butylamino)-3-oxopropyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 3-[[[3-(tert-butylamino)-3-oxopropyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103263112 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[[[3-(tert-butylamino)-3-oxopropyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)CCNCc1ccoc1C(=O)O |
| InChI | InChI=1S/C13H20N2O4/c1-13(2,3)15-10(16)4-6-14-8-9-5-7-19-11(9)12(17)18/h5,7,14H,4,6,8H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | RPIJWGUJQFSVLJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|