C10H12F3NO4 — CID 103251695
3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]furan-2-carboxylic acid (PubChem CID 103251695) has the molecular formula C10H12F3NO4 and a molecular weight of 267.20 g/mol. Its IUPAC name is 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103251695 |
| Molecular Formula | C10H12F3NO4 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1CNCCOCC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO4/c11-10(12,13)6-17-4-2-14-5-7-1-3-18-8(7)9(15)16/h1,3,14H,2,4-6H2,(H,15,16) |
| InChIKey | IRCZUSMDLKGGGK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|