C11H11NO3S — CID 103250511
3-[(thiophen-3-ylmethylamino)methyl]furan-2-carboxylic acid (PubChem CID 103250511) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-[(thiophen-3-ylmethylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(thiophen-3-ylmethylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103250511 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3-[(thiophen-3-ylmethylamino)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1CNCc1ccsc1 |
| InChI | InChI=1S/C11H11NO3S/c13-11(14)10-9(1-3-15-10)6-12-5-8-2-4-16-7-8/h1-4,7,12H,5-6H2,(H,13,14) |
| InChIKey | MNYCQSIDITZQFF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |