C11H15NO2S — CID 103250546
methyl (E)-2-methyl-4-(thiophen-3-ylmethylamino)but-2-enoate (PubChem CID 103250546) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is methyl (E)-2-methyl-4-(thiophen-3-ylmethylamino)but-2-enoate.
| Compound Name | methyl (E)-2-methyl-4-(thiophen-3-ylmethylamino)but-2-enoate |
|---|---|
| PubChem CID | 103250546 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | methyl (E)-2-methyl-4-(thiophen-3-ylmethylamino)but-2-enoate |
| SMILES | COC(=O)/C(C)=C/CNCc1ccsc1 |
| InChI | InChI=1S/C11H15NO2S/c1-9(11(13)14-2)3-5-12-7-10-4-6-15-8-10/h3-4,6,8,12H,5,7H2,1-2H3/b9-3+ |
| InChIKey | JNPBPSAIEXDAEL-YCRREMRBSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|