C10H23N3O — CID 103250759
2-amino-3-(3-ethylpentan-2-ylamino)propanamide (PubChem CID 103250759) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-amino-3-(3-ethylpentan-2-ylamino)propanamide.
| Compound Name | 2-amino-3-(3-ethylpentan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 103250759 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 2-amino-3-(3-ethylpentan-2-ylamino)propanamide |
| SMILES | CCC(CC)C(C)NCC(N)C(N)=O |
| InChI | InChI=1S/C10H23N3O/c1-4-8(5-2)7(3)13-6-9(11)10(12)14/h7-9,13H,4-6,11H2,1-3H3,(H2,12,14) |
| InChIKey | WZBAXFBIPVNWBU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |