C8H19N3O2S — CID 106162327
2-amino-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propanamide (PubChem CID 106162327) has the molecular formula C8H19N3O2S and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-amino-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propanamide.
| Compound Name | 2-amino-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 106162327 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-amino-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propanamide |
| SMILES | CSC(CO)C(C)NCC(N)C(N)=O |
| InChI | InChI=1S/C8H19N3O2S/c1-5(7(4-12)14-2)11-3-6(9)8(10)13/h5-7,11-12H,3-4,9H2,1-2H3,(H2,10,13) |
| InChIKey | CHMKSWBCRFHTRA-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |