C8H19NO2S — CID 106160798
3-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylbutan-1-ol (PubChem CID 106160798) has the molecular formula C8H19NO2S and a molecular weight of 193.31 g/mol. Its IUPAC name is 3-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106160798 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-[[(2S)-2-hydroxypropyl]amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)NC[C@H](C)O |
| InChI | InChI=1S/C8H19NO2S/c1-6(11)4-9-7(2)8(5-10)12-3/h6-11H,4-5H2,1-3H3/t6-,7?,8?/m0/s1 |
| InChIKey | AXNBCVUIBSZIKB-KKMMWDRVSA-N |
| XLogP | 0.07 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |