C15H22N2O3S — CID 106160490
4-[2-hydroxy-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propoxy]benzonitrile (PubChem CID 106160490) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propoxy]benzonitrile.
| Compound Name | 4-[2-hydroxy-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propoxy]benzonitrile |
|---|---|
| PubChem CID | 106160490 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[2-hydroxy-3-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]propoxy]benzonitrile |
| SMILES | CSC(CO)C(C)NCC(O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-11(15(9-18)21-2)17-8-13(19)10-20-14-5-3-12(7-16)4-6-14/h3-6,11,13,15,17-19H,8-10H2,1-2H3 |
| InChIKey | DINHHOMMSRNFOS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |