C9H21NO3S — CID 106158604
3-(2,2-dimethoxyethylamino)-2-methylsulfanylbutan-1-ol (PubChem CID 106158604) has the molecular formula C9H21NO3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethylamino)-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-(2,2-dimethoxyethylamino)-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106158604 |
| Molecular Formula | C9H21NO3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(2,2-dimethoxyethylamino)-2-methylsulfanylbutan-1-ol |
| SMILES | COC(CNC(C)C(CO)SC)OC |
| InChI | InChI=1S/C9H21NO3S/c1-7(8(6-11)14-4)10-5-9(12-2)13-3/h7-11H,5-6H2,1-4H3 |
| InChIKey | QRJSNVVRWNKBPJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|