C12H7Cl2N3O3S — CID 103252554
2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 103252554) has the molecular formula C12H7Cl2N3O3S and a molecular weight of 344.18 g/mol. Its IUPAC name is 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 103252554 |
| Molecular Formula | C12H7Cl2N3O3S |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C12H7Cl2N3O3S/c13-6-3-7(14)10-11(17-21-16-10)9(6)15-4-8-5(12(18)19)1-2-20-8/h1-3,15H,4H2,(H,18,19) |
| InChIKey | FEYCPLNJUBXABO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |