C13H7Cl3FN3S — CID 114841952
3,5-dichloro-N-[(4-chloro-2-fluorophenyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 114841952) has the molecular formula C13H7Cl3FN3S and a molecular weight of 362.64 g/mol. Its IUPAC name is 3,5-dichloro-N-[(4-chloro-2-fluorophenyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-[(4-chloro-2-fluorophenyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 114841952 |
| Molecular Formula | C13H7Cl3FN3S |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | 3,5-dichloro-N-[(4-chloro-2-fluorophenyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | Fc1cc(Cl)ccc1CNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C13H7Cl3FN3S/c14-7-2-1-6(10(17)3-7)5-18-11-8(15)4-9(16)12-13(11)20-21-19-12/h1-4,18H,5H2 |
| InChIKey | JJLABIOLXOTPIC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |