C10H21NO4 — CID 103254061
3-hydroxy-4-[(1-methoxy-3-methylbutan-2-yl)amino]butanoic acid (PubChem CID 103254061) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-hydroxy-4-[(1-methoxy-3-methylbutan-2-yl)amino]butanoic acid.
| Compound Name | 3-hydroxy-4-[(1-methoxy-3-methylbutan-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 103254061 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-hydroxy-4-[(1-methoxy-3-methylbutan-2-yl)amino]butanoic acid |
| SMILES | COCC(NCC(O)CC(=O)O)C(C)C |
| InChI | InChI=1S/C10H21NO4/c1-7(2)9(6-15-3)11-5-8(12)4-10(13)14/h7-9,11-12H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | ABQWKAMRQSPVFX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |