C10H22N2O4 — CID 170227512
(3S)-4-[[2-(ethylamino)-3-methoxypropyl]amino]-3-hydroxybutanoic acid (PubChem CID 170227512) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3S)-4-[[2-(ethylamino)-3-methoxypropyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (3S)-4-[[2-(ethylamino)-3-methoxypropyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 170227512 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3S)-4-[[2-(ethylamino)-3-methoxypropyl]amino]-3-hydroxybutanoic acid |
| SMILES | CCNC(CNC[C@@H](O)CC(=O)O)COC |
| InChI | InChI=1S/C10H22N2O4/c1-3-12-8(7-16-2)5-11-6-9(13)4-10(14)15/h8-9,11-13H,3-7H2,1-2H3,(H,14,15)/t8?,9-/m0/s1 |
| InChIKey | KZHKSAAFSMFSHN-GKAPJAKFSA-N |
| XLogP | -0.96 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |