C10H21N3O — CID 103254782
2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanamide (PubChem CID 103254782) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanamide.
| Compound Name | 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanamide |
|---|---|
| PubChem CID | 103254782 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2-amino-3-[(2,3-dimethylcyclopentyl)amino]propanamide |
| SMILES | CC1CCC(NCC(N)C(N)=O)C1C |
| InChI | InChI=1S/C10H21N3O/c1-6-3-4-9(7(6)2)13-5-8(11)10(12)14/h6-9,13H,3-5,11H2,1-2H3,(H2,12,14) |
| InChIKey | MQRUXDIXUAOFSW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |