C10H12BrNO2S — CID 103254800
4-[(4-bromothiophen-2-yl)methylamino]-2-methylbut-2-enoic acid (PubChem CID 103254800) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methylamino]-2-methylbut-2-enoic acid.
| Compound Name | 4-[(4-bromothiophen-2-yl)methylamino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 103254800 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 4-[(4-bromothiophen-2-yl)methylamino]-2-methylbut-2-enoic acid |
| SMILES | CC(=CCNCc1cc(Br)cs1)C(=O)O |
| InChI | InChI=1S/C10H12BrNO2S/c1-7(10(13)14)2-3-12-5-9-4-8(11)6-15-9/h2,4,6,12H,3,5H2,1H3,(H,13,14) |
| InChIKey | AYANRICXHMABRV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|