C8H10BrN3O2S — CID 60975413
2-[(4-bromothiophen-2-yl)methylamino]-N-carbamoylacetamide (PubChem CID 60975413) has the molecular formula C8H10BrN3O2S and a molecular weight of 292.16 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methylamino]-N-carbamoylacetamide.
| Compound Name | 2-[(4-bromothiophen-2-yl)methylamino]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 60975413 |
| Molecular Formula | C8H10BrN3O2S |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methylamino]-N-carbamoylacetamide |
| SMILES | NC(=O)NC(=O)CNCc1cc(Br)cs1 |
| InChI | InChI=1S/C8H10BrN3O2S/c9-5-1-6(15-4-5)2-11-3-7(13)12-8(10)14/h1,4,11H,2-3H2,(H3,10,12,13,14) |
| InChIKey | MMPGISCZSGLWGX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |