C10H13NO4 — CID 103256862
3-methyl-5-[(oxetan-3-ylamino)methyl]furan-2-carboxylic acid (PubChem CID 103256862) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-methyl-5-[(oxetan-3-ylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(oxetan-3-ylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103256862 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-methyl-5-[(oxetan-3-ylamino)methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(CNC2COC2)oc1C(=O)O |
| InChI | InChI=1S/C10H13NO4/c1-6-2-8(15-9(6)10(12)13)3-11-7-4-14-5-7/h2,7,11H,3-5H2,1H3,(H,12,13) |
| InChIKey | ALDGQNRGKDRHIJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |