C12H16N2O4 — CID 103248585
3-methyl-5-[[(2-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylic acid (PubChem CID 103248585) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-methyl-5-[[(2-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-[[(2-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103248585 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-methyl-5-[[(2-oxopiperidin-3-yl)amino]methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(CNC2CCCNC2=O)oc1C(=O)O |
| InChI | InChI=1S/C12H16N2O4/c1-7-5-8(18-10(7)12(16)17)6-14-9-3-2-4-13-11(9)15/h5,9,14H,2-4,6H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | JBUMJLNQFFVEAW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |