C19H22N2O4 — CID 95120272
3-methyl-N-[(3R)-2-oxoazepan-3-yl]-5-(phenoxymethyl)furan-2-carboxamide (PubChem CID 95120272) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-methyl-N-[(3R)-2-oxoazepan-3-yl]-5-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | 3-methyl-N-[(3R)-2-oxoazepan-3-yl]-5-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 95120272 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-methyl-N-[(3R)-2-oxoazepan-3-yl]-5-(phenoxymethyl)furan-2-carboxamide |
| SMILES | Cc1cc(COc2ccccc2)oc1C(=O)N[C@@H]1CCCCNC1=O |
| InChI | InChI=1S/C19H22N2O4/c1-13-11-15(12-24-14-7-3-2-4-8-14)25-17(13)19(23)21-16-9-5-6-10-20-18(16)22/h2-4,7-8,11,16H,5-6,9-10,12H2,1H3,(H,20,22)(H,21,23)/t16-/m1/s1 |
| InChIKey | SBOKXFNZNYBSDR-MRXNPFEDSA-N |
| XLogP | 2.57 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |