C19H23N3O4 — CID 51114950
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(2-oxoazepan-3-yl)benzamide (PubChem CID 51114950) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(2-oxoazepan-3-yl)benzamide.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(2-oxoazepan-3-yl)benzamide |
|---|---|
| PubChem CID | 51114950 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(2-oxoazepan-3-yl)benzamide |
| SMILES | Cc1noc(C)c1COc1cccc(C(=O)NC2CCCCNC2=O)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-12-16(13(2)26-22-12)11-25-15-7-5-6-14(10-15)18(23)21-17-8-3-4-9-20-19(17)24/h5-7,10,17H,3-4,8-9,11H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | YXODKSMLCQRUJI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |