C32H46O8S — CID 10326088
ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-hydroxy-2,5,11-trimethyldodeca-4,6,10-trienoate (PubChem CID 10326088) has the molecular formula C32H46O8S and a molecular weight of 590.78 g/mol. Its IUPAC name is ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-hydroxy-2,5,11-trimethyldodeca-4,6,10-trienoate.
| Compound Name | ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-hydroxy-2,5,11-trimethyldodeca-4,6,10-trienoate |
|---|---|
| PubChem CID | 10326088 |
| Molecular Formula | C32H46O8S |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | ethyl (2S,4E,6E,10E)-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-12-hydroxy-2,5,11-trimethyldodeca-4,6,10-trienoate |
| SMILES | CCOC(=O)[C@@](C)(C/C=C(C)/C=C/CC/C=C(\C)CO)[C@H]1C[C@@H](CC(=O)CS(=O)(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C32H46O8S/c1-7-38-30(35)32(6,19-18-24(2)14-10-8-11-15-25(3)22-33)29-21-27(39-31(4,5)40-29)20-26(34)23-41(36,37)28-16-12-9-13-17-28/h9-10,12-18,27,29,33H,7-8,11,19-23H2,1-6H3/b14-10+,24-18+,25-15+/t27-,29-,32+/m1/s1 |
| InChIKey | XETGADHFPYNCCO-CTCAAXPVSA-N |
| XLogP | 5.51 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|