C10H14N2O4 — CID 103261035
2-[(morpholin-4-ylamino)methyl]furan-3-carboxylic acid (PubChem CID 103261035) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-[(morpholin-4-ylamino)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[(morpholin-4-ylamino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 103261035 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[(morpholin-4-ylamino)methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CNN1CCOCC1 |
| InChI | InChI=1S/C10H14N2O4/c13-10(14)8-1-4-16-9(8)7-11-12-2-5-15-6-3-12/h1,4,11H,2-3,5-7H2,(H,13,14) |
| InChIKey | NJMSJTOHEIRRNS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |