C11H14O4S — CID 62996761
2-(oxan-4-ylsulfanylmethyl)furan-3-carboxylic acid (PubChem CID 62996761) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-(oxan-4-ylsulfanylmethyl)furan-3-carboxylic acid.
| Compound Name | 2-(oxan-4-ylsulfanylmethyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 62996761 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-(oxan-4-ylsulfanylmethyl)furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CSC1CCOCC1 |
| InChI | InChI=1S/C11H14O4S/c12-11(13)9-3-6-15-10(9)7-16-8-1-4-14-5-2-8/h3,6,8H,1-2,4-5,7H2,(H,12,13) |
| InChIKey | CWJWKMLVWYCDIB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |