C15H16O3S2 — CID 62996399
3-(oxan-4-ylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 62996399) has the molecular formula C15H16O3S2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-(oxan-4-ylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-(oxan-4-ylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 62996399 |
| Molecular Formula | C15H16O3S2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-(oxan-4-ylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2ccccc2c1CSC1CCOCC1 |
| InChI | InChI=1S/C15H16O3S2/c16-15(17)14-12(9-19-10-5-7-18-8-6-10)11-3-1-2-4-13(11)20-14/h1-4,10H,5-9H2,(H,16,17) |
| InChIKey | UDSIXCRPEXPGKW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |