C20H23NO5S — CID 120692212
2-[[2-[1-(oxan-4-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 120692212) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2-[[2-[1-(oxan-4-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-[[2-[1-(oxan-4-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120692212 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[[2-[1-(oxan-4-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | CC(NC(=O)c1ccccc1SCc1occc1C(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C20H23NO5S/c1-13(14-6-9-25-10-7-14)21-19(22)16-4-2-3-5-18(16)27-12-17-15(20(23)24)8-11-26-17/h2-5,8,11,13-14H,6-7,9-10,12H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | ZNUNZZYAVYWMNW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |