C17H19NO6S2 — CID 119181851
2-[[2-(3-methylsulfonylpropylcarbamoyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 119181851) has the molecular formula C17H19NO6S2 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[[2-(3-methylsulfonylpropylcarbamoyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-[[2-(3-methylsulfonylpropylcarbamoyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119181851 |
| Molecular Formula | C17H19NO6S2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-[[2-(3-methylsulfonylpropylcarbamoyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | CS(=O)(=O)CCCNC(=O)c1ccccc1SCc1occc1C(=O)O |
| InChI | InChI=1S/C17H19NO6S2/c1-26(22,23)10-4-8-18-16(19)13-5-2-3-6-15(13)25-11-14-12(17(20)21)7-9-24-14/h2-3,5-7,9H,4,8,10-11H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | ZZJXAYALAITUGI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|