C19H21NO4S — CID 119185074
2-[[2-[cyclopropylmethyl(ethyl)carbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 119185074) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[[2-[cyclopropylmethyl(ethyl)carbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-[[2-[cyclopropylmethyl(ethyl)carbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119185074 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-[[2-[cyclopropylmethyl(ethyl)carbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | CCN(CC1CC1)C(=O)c1ccccc1SCc1occc1C(=O)O |
| InChI | InChI=1S/C19H21NO4S/c1-2-20(11-13-7-8-13)18(21)15-5-3-4-6-17(15)25-12-16-14(19(22)23)9-10-24-16/h3-6,9-10,13H,2,7-8,11-12H2,1H3,(H,22,23) |
| InChIKey | LFHXLAHIKIJTEE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |