C19H21NO6S — CID 119186890
2-[[2-[3-(2-methoxyethoxy)azetidine-1-carbonyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 119186890) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[[2-[3-(2-methoxyethoxy)azetidine-1-carbonyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-[[2-[3-(2-methoxyethoxy)azetidine-1-carbonyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119186890 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[[2-[3-(2-methoxyethoxy)azetidine-1-carbonyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | COCCOC1CN(C(=O)c2ccccc2SCc2occc2C(=O)O)C1 |
| InChI | InChI=1S/C19H21NO6S/c1-24-8-9-25-13-10-20(11-13)18(21)15-4-2-3-5-17(15)27-12-16-14(19(22)23)6-7-26-16/h2-7,13H,8-12H2,1H3,(H,22,23) |
| InChIKey | JSPLOOIFSJBJGQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|