C18H18N2O6S — CID 119183357
2-[[2-(2-carbamoylmorpholine-4-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 119183357) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[[2-(2-carbamoylmorpholine-4-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-[[2-(2-carbamoylmorpholine-4-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119183357 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-[[2-(2-carbamoylmorpholine-4-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | NC(=O)C1CN(C(=O)c2ccccc2SCc2occc2C(=O)O)CCO1 |
| InChI | InChI=1S/C18H18N2O6S/c19-16(21)13-9-20(6-8-26-13)17(22)12-3-1-2-4-15(12)27-10-14-11(18(23)24)5-7-25-14/h1-5,7,13H,6,8-10H2,(H2,19,21)(H,23,24) |
| InChIKey | CWIZWHKUIKUVIY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |