C24H24N2O4S — CID 56580779
methyl 2-[[2-(3-anilinopyrrolidine-1-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylate (PubChem CID 56580779) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is methyl 2-[[2-(3-anilinopyrrolidine-1-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[2-(3-anilinopyrrolidine-1-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 56580779 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl 2-[[2-(3-anilinopyrrolidine-1-carbonyl)phenyl]sulfanylmethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CSc1ccccc1C(=O)N1CCC(Nc2ccccc2)C1 |
| InChI | InChI=1S/C24H24N2O4S/c1-29-24(28)19-12-14-30-21(19)16-31-22-10-6-5-9-20(22)23(27)26-13-11-18(15-26)25-17-7-3-2-4-8-17/h2-10,12,14,18,25H,11,13,15-16H2,1H3 |
| InChIKey | QXOSKTHXUFMOKS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |