C21H23NO4S — CID 119179308
2-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 119179308) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 2-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119179308 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[[2-[2-(cyclohexen-1-yl)ethylcarbamoyl]phenyl]sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | O=C(NCCC1=CCCCC1)c1ccccc1SCc1occc1C(=O)O |
| InChI | InChI=1S/C21H23NO4S/c23-20(22-12-10-15-6-2-1-3-7-15)17-8-4-5-9-19(17)27-14-18-16(21(24)25)11-13-26-18/h4-6,8-9,11,13H,1-3,7,10,12,14H2,(H,22,23)(H,24,25) |
| InChIKey | WDPKBXSKMLMBGT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|