C33H27Cl3O4 — CID 10326144
(2,4,5-trichlorophenyl) 4-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]ethynyl]phenyl]benzoate (PubChem CID 10326144) has the molecular formula C33H27Cl3O4 and a molecular weight of 593.93 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) 4-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]ethynyl]phenyl]benzoate.
| Compound Name | (2,4,5-trichlorophenyl) 4-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]ethynyl]phenyl]benzoate |
|---|---|
| PubChem CID | 10326144 |
| Molecular Formula | C33H27Cl3O4 |
| Molecular Weight | 593.93 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | (2,4,5-trichlorophenyl) 4-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phenyl]ethynyl]phenyl]benzoate |
| SMILES | CC(C)(C)OCCOc1ccc(C#Cc2ccc(-c3ccc(C(=O)Oc4cc(Cl)c(Cl)cc4Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H27Cl3O4/c1-33(2,3)39-19-18-38-27-16-8-23(9-17-27)5-4-22-6-10-24(11-7-22)25-12-14-26(15-13-25)32(37)40-31-21-29(35)28(34)20-30(31)36/h6-17,20-21H,18-19H2,1-3H3 |
| InChIKey | YMQDLVQBMFOXMV-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.93 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|