C27H27Cl3O3 — CID 10368893
(2,4,5-trichlorophenyl) 4-(4-octoxyphenyl)benzoate (PubChem CID 10368893) has the molecular formula C27H27Cl3O3 and a molecular weight of 505.87 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) 4-(4-octoxyphenyl)benzoate.
| Compound Name | (2,4,5-trichlorophenyl) 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 10368893 |
| Molecular Formula | C27H27Cl3O3 |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | (2,4,5-trichlorophenyl) 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3cc(Cl)c(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C27H27Cl3O3/c1-2-3-4-5-6-7-16-32-22-14-12-20(13-15-22)19-8-10-21(11-9-19)27(31)33-26-18-24(29)23(28)17-25(26)30/h8-15,17-18H,2-7,16H2,1H3 |
| InChIKey | XLTFOTSNIVLSRI-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|