About [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate
[4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate (PubChem CID 129279118) has the molecular formula C30H35ClO3
and a molecular weight of 479.06 g/mol. Its IUPAC name is [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate.
Molecular Properties
| Compound Name | [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate |
| PubChem CID | 129279118 |
| Molecular Formula | C30H35ClO3 |
| Molecular Weight | 479.06 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCl)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H35ClO3/c1-2-3-4-5-6-7-8-9-22-33-28-18-14-25(15-19-28)26-16-20-29(21-17-26)34-30(32)27-12-10-24(23-31)11-13-27/h10-21H,2-9,22-23H2,1H3 |
| InChIKey | XJVWZPJYVDPQMD-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.06 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate?
The IUPAC name of [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate (CID 129279118) is [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate.
What is the SMILES notation for [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate?
The canonical SMILES for [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate is CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCl)cc3)cc2)cc1.
What is the InChIKey of [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate?
The InChIKey is XJVWZPJYVDPQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H35ClO3/c1-2-3-4-5-6-7-8-9-22-33-28-18-14-25(15-19-28)26-16-20-29(21-17-26)34-30(32)27-12-10-24(23-31)11-13-27/h10-21H,2-9,22-23H2,1H3.
What are the key properties of [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate?
[4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate has a molecular weight of 479.06 g/mol, XLogP of 8.83, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-decoxyphenyl)phenyl] 4-(chloromethyl)benzoate is sourced from PubChem (CID 129279118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).