C23H19Cl3O4 — CID 10389783
(2,4,5-trichlorophenyl) 4-(4-butoxyphenoxy)benzoate (PubChem CID 10389783) has the molecular formula C23H19Cl3O4 and a molecular weight of 465.76 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) 4-(4-butoxyphenoxy)benzoate.
| Compound Name | (2,4,5-trichlorophenyl) 4-(4-butoxyphenoxy)benzoate |
|---|---|
| PubChem CID | 10389783 |
| Molecular Formula | C23H19Cl3O4 |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | (2,4,5-trichlorophenyl) 4-(4-butoxyphenoxy)benzoate |
| SMILES | CCCCOc1ccc(Oc2ccc(C(=O)Oc3cc(Cl)c(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C23H19Cl3O4/c1-2-3-12-28-16-8-10-18(11-9-16)29-17-6-4-15(5-7-17)23(27)30-22-14-20(25)19(24)13-21(22)26/h4-11,13-14H,2-3,12H2,1H3 |
| InChIKey | BMAWWNYKVILLGT-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|