C10H19NO4 — CID 103261490
4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-2-ethylbut-2-enoic acid (PubChem CID 103261490) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-2-ethylbut-2-enoic acid.
| Compound Name | 4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103261490 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCNC(C)(CO)CO)C(=O)O |
| InChI | InChI=1S/C10H19NO4/c1-3-8(9(14)15)4-5-11-10(2,6-12)7-13/h4,11-13H,3,5-7H2,1-2H3,(H,14,15) |
| InChIKey | ZRRWHXWLPMMATA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|