C8H12F3NO3 — CID 103261644
2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoic acid (PubChem CID 103261644) has the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoic acid.
| Compound Name | 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103261644 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-ethyl-4-(2,2,2-trifluoroethoxyamino)but-2-enoic acid |
| SMILES | CCC(=CCNOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H12F3NO3/c1-2-6(7(13)14)3-4-12-15-5-8(9,10)11/h3,12H,2,4-5H2,1H3,(H,13,14) |
| InChIKey | WFOBFRQZQGYMRK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|