C8H15NO3 — CID 103263977
3-methoxy-2-[(1-methylcyclopropyl)amino]propanoic acid (PubChem CID 103263977) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-methoxy-2-[(1-methylcyclopropyl)amino]propanoic acid.
| Compound Name | 3-methoxy-2-[(1-methylcyclopropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 103263977 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 3-methoxy-2-[(1-methylcyclopropyl)amino]propanoic acid |
| SMILES | COCC(NC1(C)CC1)C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-8(3-4-8)9-6(5-12-2)7(10)11/h6,9H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | ZNNINCIZTNDIOB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |