C5H8ClNO4 — CID 131230342
(2R)-2-(carbonochloridoylamino)-3-methoxypropanoic acid (PubChem CID 131230342) has the molecular formula C5H8ClNO4 and a molecular weight of 181.57 g/mol. Its IUPAC name is (2R)-2-(carbonochloridoylamino)-3-methoxypropanoic acid.
| Compound Name | (2R)-2-(carbonochloridoylamino)-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 131230342 |
| Molecular Formula | C5H8ClNO4 |
| Molecular Weight | 181.57 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | (2R)-2-(carbonochloridoylamino)-3-methoxypropanoic acid |
| SMILES | COC[C@@H](NC(=O)Cl)C(=O)O |
| InChI | InChI=1S/C5H8ClNO4/c1-11-2-3(4(8)9)7-5(6)10/h3H,2H2,1H3,(H,7,10)(H,8,9)/t3-/m1/s1 |
| InChIKey | FCXIRUWHNSNJLK-GSVOUGTGSA-N |
| XLogP | 0.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.57 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|