C9H12N2O2S — CID 103267930
3-methyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid (PubChem CID 103267930) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-methyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid.
| Compound Name | 3-methyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103267930 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-methyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNCc1cncs1 |
| InChI | InChI=1S/C9H12N2O2S/c1-7(2-9(12)13)3-10-4-8-5-11-6-14-8/h2,5-6,10H,3-4H2,1H3,(H,12,13) |
| InChIKey | CBYXEMJZLDLMLR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|