C13H17NO3 — CID 103268488
(Z)-2-ethyl-4-[(4-hydroxyphenyl)methylamino]but-2-enoic acid (PubChem CID 103268488) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (Z)-2-ethyl-4-[(4-hydroxyphenyl)methylamino]but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-[(4-hydroxyphenyl)methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103268488 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (Z)-2-ethyl-4-[(4-hydroxyphenyl)methylamino]but-2-enoic acid |
| SMILES | CC/C(=C/CNCc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C13H17NO3/c1-2-11(13(16)17)7-8-14-9-10-3-5-12(15)6-4-10/h3-7,14-15H,2,8-9H2,1H3,(H,16,17)/b11-7- |
| InChIKey | YRIIMYSCOXCFSI-XFFZJAGNSA-N |
| XLogP | 1.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|