C13H15F2NO2 — CID 103251583
(Z)-4-[(2,5-difluorophenyl)methylamino]-2-ethylbut-2-enoic acid (PubChem CID 103251583) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is (Z)-4-[(2,5-difluorophenyl)methylamino]-2-ethylbut-2-enoic acid.
| Compound Name | (Z)-4-[(2,5-difluorophenyl)methylamino]-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 103251583 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (Z)-4-[(2,5-difluorophenyl)methylamino]-2-ethylbut-2-enoic acid |
| SMILES | CC/C(=C/CNCc1cc(F)ccc1F)C(=O)O |
| InChI | InChI=1S/C13H15F2NO2/c1-2-9(13(17)18)5-6-16-8-10-7-11(14)3-4-12(10)15/h3-5,7,16H,2,6,8H2,1H3,(H,17,18)/b9-5- |
| InChIKey | IRRYTRPJMBENDN-UITAMQMPSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|