C11H16ClNO2 — CID 103270923
3-[[(5-chlorofuran-2-yl)methylamino]methyl]cyclopentan-1-ol (PubChem CID 103270923) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-[[(5-chlorofuran-2-yl)methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 3-[[(5-chlorofuran-2-yl)methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 103270923 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-[[(5-chlorofuran-2-yl)methylamino]methyl]cyclopentan-1-ol |
| SMILES | OC1CCC(CNCc2ccc(Cl)o2)C1 |
| InChI | InChI=1S/C11H16ClNO2/c12-11-4-3-10(15-11)7-13-6-8-1-2-9(14)5-8/h3-4,8-9,13-14H,1-2,5-7H2 |
| InChIKey | BPQHGGOQDJOSMM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |