About 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol
3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol (PubChem CID 106121094) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol |
| PubChem CID | 106121094 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol |
| SMILES | OC1CCC(CNCc2cnco2)C1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-2-1-8(3-9)4-11-5-10-6-12-7-14-10/h6-9,11,13H,1-5H2 |
| InChIKey | IAXIINUCCQNOBQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol?
The IUPAC name of 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol (CID 106121094) is 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol.
What is the SMILES notation for 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol?
The canonical SMILES for 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol is OC1CCC(CNCc2cnco2)C1.
What is the InChIKey of 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol?
The InChIKey is IAXIINUCCQNOBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c13-9-2-1-8(3-9)4-11-5-10-6-12-7-14-10/h6-9,11,13H,1-5H2.
What are the key properties of 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol?
3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol has a molecular weight of 196.25 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol is sourced from PubChem (CID 106121094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).