C10H16N2O2 — CID 106121094
3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol (PubChem CID 106121094) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol.
| Compound Name | 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106121094 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclopentan-1-ol |
| SMILES | OC1CCC(CNCc2cnco2)C1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-2-1-8(3-9)4-11-5-10-6-12-7-14-10/h6-9,11,13H,1-5H2 |
| InChIKey | IAXIINUCCQNOBQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |