C11H18N2O2 — CID 106124531
3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclohexan-1-ol (PubChem CID 106124531) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclohexan-1-ol.
| Compound Name | 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106124531 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-[(1,3-oxazol-5-ylmethylamino)methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(CNCc2cnco2)C1 |
| InChI | InChI=1S/C11H18N2O2/c14-10-3-1-2-9(4-10)5-12-6-11-7-13-8-15-11/h7-10,12,14H,1-6H2 |
| InChIKey | WXFXAUDNVGTJBT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |