C32H28Cl4N2O8 — CID 10327463
[(2R,3S,4R,5R,6S)-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 2-chloroacetate (PubChem CID 10327463) has the molecular formula C32H28Cl4N2O8 and a molecular weight of 710.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 2-chloroacetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 10327463 |
| Molecular Formula | C32H28Cl4N2O8 |
| Molecular Weight | 710.39 g/mol |
| Exact Mass | 708.06 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] 2-chloroacetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OC(=O)CCl)[C@H](OCc2ccccc2)[C@H]1N1C(=O)c2ccccc2C1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C32H28Cl4N2O8/c33-15-24(39)45-26-23(18-42-16-19-9-3-1-4-10-19)44-30(46-31(37)32(34,35)36)25(27(26)43-17-20-11-5-2-6-12-20)38-28(40)21-13-7-8-14-22(21)29(38)41/h1-14,23,25-27,30,37H,15-18H2/b37-31+/t23-,25-,26-,27-,30+/m1/s1 |
| InChIKey | JUVXNQBZHBQWRG-FNTIILFJSA-N |
| XLogP | 5.69 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|