C13H22N4O3S — CID 103286872
2-[4-amino-2-(methylsulfamoyl)anilino]-N-propylpropanamide (PubChem CID 103286872) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[4-amino-2-(methylsulfamoyl)anilino]-N-propylpropanamide.
| Compound Name | 2-[4-amino-2-(methylsulfamoyl)anilino]-N-propylpropanamide |
|---|---|
| PubChem CID | 103286872 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[4-amino-2-(methylsulfamoyl)anilino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Nc1ccc(N)cc1S(=O)(=O)NC |
| InChI | InChI=1S/C13H22N4O3S/c1-4-7-16-13(18)9(2)17-11-6-5-10(14)8-12(11)21(19,20)15-3/h5-6,8-9,15,17H,4,7,14H2,1-3H3,(H,16,18) |
| InChIKey | KESYNMVOVSTJSZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|