C14H19N3O2S2 — CID 103286878
5-amino-N-methyl-2-(1-thiophen-2-ylpropylamino)benzenesulfonamide (PubChem CID 103286878) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 5-amino-N-methyl-2-(1-thiophen-2-ylpropylamino)benzenesulfonamide.
| Compound Name | 5-amino-N-methyl-2-(1-thiophen-2-ylpropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 103286878 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-amino-N-methyl-2-(1-thiophen-2-ylpropylamino)benzenesulfonamide |
| SMILES | CCC(Nc1ccc(N)cc1S(=O)(=O)NC)c1cccs1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-3-11(13-5-4-8-20-13)17-12-7-6-10(15)9-14(12)21(18,19)16-2/h4-9,11,16-17H,3,15H2,1-2H3 |
| InChIKey | YQGWXOKIKCFCQG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|